About 5-bromo-3-N-methylpyridine-2,3-diamine
5-bromo-3-N-methylpyridine-2,3-diamine (PubChem CID 10035731) has the molecular formula C6H8BrN3
and a molecular weight of 202.06 g/mol. Its IUPAC name is 5-bromo-3-N-methylpyridine-2,3-diamine.
Molecular Properties
| Compound Name | 5-bromo-3-N-methylpyridine-2,3-diamine |
| PubChem CID | 10035731 |
| Molecular Formula | C6H8BrN3 |
| Molecular Weight | 202.06 g/mol |
| Exact Mass | 200.99 |
| IUPAC Name | 5-bromo-3-N-methylpyridine-2,3-diamine |
| SMILES | CNc1cc(Br)cnc1N |
| InChI | InChI=1S/C6H8BrN3/c1-9-5-2-4(7)3-10-6(5)8/h2-3,9H,1H3,(H2,8,10) |
| InChIKey | IEZBJIKJXNNYFC-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.06 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-3-N-methylpyridine-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-N-methylpyridine-2,3-diamine?
The IUPAC name of 5-bromo-3-N-methylpyridine-2,3-diamine (CID 10035731) is 5-bromo-3-N-methylpyridine-2,3-diamine.
What is the SMILES notation for 5-bromo-3-N-methylpyridine-2,3-diamine?
The canonical SMILES for 5-bromo-3-N-methylpyridine-2,3-diamine is CNc1cc(Br)cnc1N.
What is the InChIKey of 5-bromo-3-N-methylpyridine-2,3-diamine?
The InChIKey is IEZBJIKJXNNYFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8BrN3/c1-9-5-2-4(7)3-10-6(5)8/h2-3,9H,1H3,(H2,8,10).
What are the key properties of 5-bromo-3-N-methylpyridine-2,3-diamine?
5-bromo-3-N-methylpyridine-2,3-diamine has a molecular weight of 202.06 g/mol, XLogP of 1.47, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-N-methylpyridine-2,3-diamine is sourced from PubChem (CID 10035731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).