About 5-phenylpent-1-yn-3-yl acetate
5-phenylpent-1-yn-3-yl acetate (PubChem CID 10035749) has the molecular formula C13H14O2
and a molecular weight of 202.25 g/mol. Its IUPAC name is 5-phenylpent-1-yn-3-yl acetate.
Molecular Properties
| Compound Name | 5-phenylpent-1-yn-3-yl acetate |
| PubChem CID | 10035749 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 5-phenylpent-1-yn-3-yl acetate |
| SMILES | C#CC(CCc1ccccc1)OC(C)=O |
| InChI | InChI=1S/C13H14O2/c1-3-13(15-11(2)14)10-9-12-7-5-4-6-8-12/h1,4-8,13H,9-10H2,2H3 |
| InChIKey | QGQQCLAEPHLVPU-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-phenylpent-1-yn-3-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenylpent-1-yn-3-yl acetate?
The IUPAC name of 5-phenylpent-1-yn-3-yl acetate (CID 10035749) is 5-phenylpent-1-yn-3-yl acetate.
What is the SMILES notation for 5-phenylpent-1-yn-3-yl acetate?
The canonical SMILES for 5-phenylpent-1-yn-3-yl acetate is C#CC(CCc1ccccc1)OC(C)=O.
What is the InChIKey of 5-phenylpent-1-yn-3-yl acetate?
The InChIKey is QGQQCLAEPHLVPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O2/c1-3-13(15-11(2)14)10-9-12-7-5-4-6-8-12/h1,4-8,13H,9-10H2,2H3.
What are the key properties of 5-phenylpent-1-yn-3-yl acetate?
5-phenylpent-1-yn-3-yl acetate has a molecular weight of 202.25 g/mol, XLogP of 2.18, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenylpent-1-yn-3-yl acetate is sourced from PubChem (CID 10035749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).