C13H18S — CID 10035909
10,10-dimethyl-2-thiatricyclo[6.3.1.04,12]dodeca-3,7-diene (PubChem CID 10035909) has the molecular formula C13H18S and a molecular weight of 206.35 g/mol. Its IUPAC name is 10,10-dimethyl-2-thiatricyclo[6.3.1.04,12]dodeca-3,7-diene.
| Compound Name | 10,10-dimethyl-2-thiatricyclo[6.3.1.04,12]dodeca-3,7-diene |
|---|---|
| PubChem CID | 10035909 |
| Molecular Formula | C13H18S |
| Molecular Weight | 206.35 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 10,10-dimethyl-2-thiatricyclo[6.3.1.04,12]dodeca-3,7-diene |
| SMILES | CC1(C)CC2=CCCC3=CSC(C1)C32 |
| InChI | InChI=1S/C13H18S/c1-13(2)6-9-4-3-5-10-8-14-11(7-13)12(9)10/h4,8,11-12H,3,5-7H2,1-2H3 |
| InChIKey | KXSNZHFTMLAEQE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.35 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|