About 1,6-dimethyl-2-methylsulfanyl-4H-imidazo[4,5-b]pyridin-5-one
1,6-dimethyl-2-methylsulfanyl-4H-imidazo[4,5-b]pyridin-5-one (PubChem CID 10036000) has the molecular formula C9H11N3OS
and a molecular weight of 209.27 g/mol. Its IUPAC name is 1,6-dimethyl-2-methylsulfanyl-4H-imidazo[4,5-b]pyridin-5-one.
Molecular Properties
| Compound Name | 1,6-dimethyl-2-methylsulfanyl-4H-imidazo[4,5-b]pyridin-5-one |
| PubChem CID | 10036000 |
| Molecular Formula | C9H11N3OS |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 1,6-dimethyl-2-methylsulfanyl-4H-imidazo[4,5-b]pyridin-5-one |
| SMILES | CSc1nc2[nH]c(=O)c(C)cc2n1C |
| InChI | InChI=1S/C9H11N3OS/c1-5-4-6-7(10-8(5)13)11-9(14-3)12(6)2/h4H,1-3H3,(H,10,13) |
| InChIKey | CXDLQFZWALSIBF-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,6-dimethyl-2-methylsulfanyl-4H-imidazo[4,5-b]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-dimethyl-2-methylsulfanyl-4H-imidazo[4,5-b]pyridin-5-one?
The IUPAC name of 1,6-dimethyl-2-methylsulfanyl-4H-imidazo[4,5-b]pyridin-5-one (CID 10036000) is 1,6-dimethyl-2-methylsulfanyl-4H-imidazo[4,5-b]pyridin-5-one.
What is the SMILES notation for 1,6-dimethyl-2-methylsulfanyl-4H-imidazo[4,5-b]pyridin-5-one?
The canonical SMILES for 1,6-dimethyl-2-methylsulfanyl-4H-imidazo[4,5-b]pyridin-5-one is CSc1nc2[nH]c(=O)c(C)cc2n1C.
What is the InChIKey of 1,6-dimethyl-2-methylsulfanyl-4H-imidazo[4,5-b]pyridin-5-one?
The InChIKey is CXDLQFZWALSIBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3OS/c1-5-4-6-7(10-8(5)13)11-9(14-3)12(6)2/h4H,1-3H3,(H,10,13).
What are the key properties of 1,6-dimethyl-2-methylsulfanyl-4H-imidazo[4,5-b]pyridin-5-one?
1,6-dimethyl-2-methylsulfanyl-4H-imidazo[4,5-b]pyridin-5-one has a molecular weight of 209.27 g/mol, XLogP of 1.29, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dimethyl-2-methylsulfanyl-4H-imidazo[4,5-b]pyridin-5-one is sourced from PubChem (CID 10036000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).