About 2-methyl-5,6-dihydro-[1]benzoxepino[5,4-d]pyrimidine
2-methyl-5,6-dihydro-[1]benzoxepino[5,4-d]pyrimidine (PubChem CID 10036097) has the molecular formula C13H12N2O
and a molecular weight of 212.25 g/mol. Its IUPAC name is 2-methyl-5,6-dihydro-[1]benzoxepino[5,4-d]pyrimidine.
Molecular Properties
| Compound Name | 2-methyl-5,6-dihydro-[1]benzoxepino[5,4-d]pyrimidine |
| PubChem CID | 10036097 |
| Molecular Formula | C13H12N2O |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 2-methyl-5,6-dihydro-[1]benzoxepino[5,4-d]pyrimidine |
| SMILES | Cc1ncc2c(n1)-c1ccccc1OCC2 |
| InChI | InChI=1S/C13H12N2O/c1-9-14-8-10-6-7-16-12-5-3-2-4-11(12)13(10)15-9/h2-5,8H,6-7H2,1H3 |
| InChIKey | YZJOCVVXHZUCCP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-5,6-dihydro-[1]benzoxepino[5,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5,6-dihydro-[1]benzoxepino[5,4-d]pyrimidine?
The IUPAC name of 2-methyl-5,6-dihydro-[1]benzoxepino[5,4-d]pyrimidine (CID 10036097) is 2-methyl-5,6-dihydro-[1]benzoxepino[5,4-d]pyrimidine.
What is the SMILES notation for 2-methyl-5,6-dihydro-[1]benzoxepino[5,4-d]pyrimidine?
The canonical SMILES for 2-methyl-5,6-dihydro-[1]benzoxepino[5,4-d]pyrimidine is Cc1ncc2c(n1)-c1ccccc1OCC2.
What is the InChIKey of 2-methyl-5,6-dihydro-[1]benzoxepino[5,4-d]pyrimidine?
The InChIKey is YZJOCVVXHZUCCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O/c1-9-14-8-10-6-7-16-12-5-3-2-4-11(12)13(10)15-9/h2-5,8H,6-7H2,1H3.
What are the key properties of 2-methyl-5,6-dihydro-[1]benzoxepino[5,4-d]pyrimidine?
2-methyl-5,6-dihydro-[1]benzoxepino[5,4-d]pyrimidine has a molecular weight of 212.25 g/mol, XLogP of 2.39, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5,6-dihydro-[1]benzoxepino[5,4-d]pyrimidine is sourced from PubChem (CID 10036097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).