About 4-ethenyl-1-methyl-3,6-dihydro-2H-pyridine
4-ethenyl-1-methyl-3,6-dihydro-2H-pyridine (PubChem CID 10036134) has the molecular formula C8H13N
and a molecular weight of 123.20 g/mol. Its IUPAC name is 4-ethenyl-1-methyl-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 4-ethenyl-1-methyl-3,6-dihydro-2H-pyridine |
| PubChem CID | 10036134 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | 4-ethenyl-1-methyl-3,6-dihydro-2H-pyridine |
| SMILES | C=CC1=CCN(C)CC1 |
| InChI | InChI=1S/C8H13N/c1-3-8-4-6-9(2)7-5-8/h3-4H,1,5-7H2,2H3 |
| InChIKey | HGWVHVYJNWEYTP-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-ethenyl-1-methyl-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenyl-1-methyl-3,6-dihydro-2H-pyridine?
The IUPAC name of 4-ethenyl-1-methyl-3,6-dihydro-2H-pyridine (CID 10036134) is 4-ethenyl-1-methyl-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 4-ethenyl-1-methyl-3,6-dihydro-2H-pyridine?
The canonical SMILES for 4-ethenyl-1-methyl-3,6-dihydro-2H-pyridine is C=CC1=CCN(C)CC1.
What is the InChIKey of 4-ethenyl-1-methyl-3,6-dihydro-2H-pyridine?
The InChIKey is HGWVHVYJNWEYTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N/c1-3-8-4-6-9(2)7-5-8/h3-4H,1,5-7H2,2H3.
What are the key properties of 4-ethenyl-1-methyl-3,6-dihydro-2H-pyridine?
4-ethenyl-1-methyl-3,6-dihydro-2H-pyridine has a molecular weight of 123.20 g/mol, XLogP of 1.43, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenyl-1-methyl-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 10036134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).