About 8'-hydroxyspiro[1,3-dioxolane-2,4'-naphthalene]-1'-one
8'-hydroxyspiro[1,3-dioxolane-2,4'-naphthalene]-1'-one (PubChem CID 10036320) has the molecular formula C12H10O4
and a molecular weight of 218.21 g/mol. Its IUPAC name is 8'-hydroxyspiro[1,3-dioxolane-2,4'-naphthalene]-1'-one.
Molecular Properties
| Compound Name | 8'-hydroxyspiro[1,3-dioxolane-2,4'-naphthalene]-1'-one |
| PubChem CID | 10036320 |
| Molecular Formula | C12H10O4 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 8'-hydroxyspiro[1,3-dioxolane-2,4'-naphthalene]-1'-one |
| SMILES | O=C1C=CC2(OCCO2)c2cccc(O)c21 |
| InChI | InChI=1S/C12H10O4/c13-9-3-1-2-8-11(9)10(14)4-5-12(8)15-6-7-16-12/h1-5,13H,6-7H2 |
| InChIKey | WYNYDWDGVJWGKK-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8'-hydroxyspiro[1,3-dioxolane-2,4'-naphthalene]-1'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8'-hydroxyspiro[1,3-dioxolane-2,4'-naphthalene]-1'-one?
The IUPAC name of 8'-hydroxyspiro[1,3-dioxolane-2,4'-naphthalene]-1'-one (CID 10036320) is 8'-hydroxyspiro[1,3-dioxolane-2,4'-naphthalene]-1'-one.
What is the SMILES notation for 8'-hydroxyspiro[1,3-dioxolane-2,4'-naphthalene]-1'-one?
The canonical SMILES for 8'-hydroxyspiro[1,3-dioxolane-2,4'-naphthalene]-1'-one is O=C1C=CC2(OCCO2)c2cccc(O)c21.
What is the InChIKey of 8'-hydroxyspiro[1,3-dioxolane-2,4'-naphthalene]-1'-one?
The InChIKey is WYNYDWDGVJWGKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O4/c13-9-3-1-2-8-11(9)10(14)4-5-12(8)15-6-7-16-12/h1-5,13H,6-7H2.
What are the key properties of 8'-hydroxyspiro[1,3-dioxolane-2,4'-naphthalene]-1'-one?
8'-hydroxyspiro[1,3-dioxolane-2,4'-naphthalene]-1'-one has a molecular weight of 218.21 g/mol, XLogP of 1.34, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8'-hydroxyspiro[1,3-dioxolane-2,4'-naphthalene]-1'-one is sourced from PubChem (CID 10036320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).