About chlorozinc(1+);N,N-dimethylaniline
chlorozinc(1+);N,N-dimethylaniline (PubChem CID 10036436) has the molecular formula C8H10ClNZn
and a molecular weight of 221.02 g/mol. Its IUPAC name is chlorozinc(1+);N,N-dimethylaniline.
Molecular Properties
| Compound Name | chlorozinc(1+);N,N-dimethylaniline |
| PubChem CID | 10036436 |
| Molecular Formula | C8H10ClNZn |
| Molecular Weight | 221.02 g/mol |
| Exact Mass | 218.98 |
| IUPAC Name | chlorozinc(1+);N,N-dimethylaniline |
| SMILES | CN(C)c1cc[c-]cc1.Cl[Zn+] |
| InChI | InChI=1S/C8H10N.ClH.Zn/c1-9(2)8-6-4-3-5-7-8;;/h4-7H,1-2H3;1H;/q-1;;+2/p-1 |
| InChIKey | IQGPKNIQYKMVNF-UHFFFAOYSA-M |
| XLogP | 2.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.02 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze chlorozinc(1+);N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorozinc(1+);N,N-dimethylaniline?
The IUPAC name of chlorozinc(1+);N,N-dimethylaniline (CID 10036436) is chlorozinc(1+);N,N-dimethylaniline.
What is the SMILES notation for chlorozinc(1+);N,N-dimethylaniline?
The canonical SMILES for chlorozinc(1+);N,N-dimethylaniline is CN(C)c1cc[c-]cc1.Cl[Zn+].
What is the InChIKey of chlorozinc(1+);N,N-dimethylaniline?
The InChIKey is IQGPKNIQYKMVNF-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H10N.ClH.Zn/c1-9(2)8-6-4-3-5-7-8;;/h4-7H,1-2H3;1H;/q-1;;+2/p-1.
What are the key properties of chlorozinc(1+);N,N-dimethylaniline?
chlorozinc(1+);N,N-dimethylaniline has a molecular weight of 221.02 g/mol, XLogP of 2.24, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chlorozinc(1+);N,N-dimethylaniline is sourced from PubChem (CID 10036436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).