About [(1R,5S)-3-ethynyl-5-hydroxy-2-methylcyclohex-2-en-1-yl] butanoate
[(1R,5S)-3-ethynyl-5-hydroxy-2-methylcyclohex-2-en-1-yl] butanoate (PubChem CID 10036499) has the molecular formula C13H18O3
and a molecular weight of 222.28 g/mol. Its IUPAC name is [(1R,5S)-3-ethynyl-5-hydroxy-2-methylcyclohex-2-en-1-yl] butanoate.
Molecular Properties
| Compound Name | [(1R,5S)-3-ethynyl-5-hydroxy-2-methylcyclohex-2-en-1-yl] butanoate |
| PubChem CID | 10036499 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | [(1R,5S)-3-ethynyl-5-hydroxy-2-methylcyclohex-2-en-1-yl] butanoate |
| SMILES | C#CC1=C(C)[C@H](OC(=O)CCC)C[C@@H](O)C1 |
| InChI | InChI=1S/C13H18O3/c1-4-6-13(15)16-12-8-11(14)7-10(5-2)9(12)3/h2,11-12,14H,4,6-8H2,1,3H3/t11-,12+/m0/s1 |
| InChIKey | FHQXZNSTGNVWQI-NWDGAFQWSA-N |
| XLogP | 1.80 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(1R,5S)-3-ethynyl-5-hydroxy-2-methylcyclohex-2-en-1-yl] butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,5S)-3-ethynyl-5-hydroxy-2-methylcyclohex-2-en-1-yl] butanoate?
The IUPAC name of [(1R,5S)-3-ethynyl-5-hydroxy-2-methylcyclohex-2-en-1-yl] butanoate (CID 10036499) is [(1R,5S)-3-ethynyl-5-hydroxy-2-methylcyclohex-2-en-1-yl] butanoate.
What is the SMILES notation for [(1R,5S)-3-ethynyl-5-hydroxy-2-methylcyclohex-2-en-1-yl] butanoate?
The canonical SMILES for [(1R,5S)-3-ethynyl-5-hydroxy-2-methylcyclohex-2-en-1-yl] butanoate is C#CC1=C(C)[C@H](OC(=O)CCC)C[C@@H](O)C1.
What is the InChIKey of [(1R,5S)-3-ethynyl-5-hydroxy-2-methylcyclohex-2-en-1-yl] butanoate?
The InChIKey is FHQXZNSTGNVWQI-NWDGAFQWSA-N. The full InChI is InChI=1S/C13H18O3/c1-4-6-13(15)16-12-8-11(14)7-10(5-2)9(12)3/h2,11-12,14H,4,6-8H2,1,3H3/t11-,12+/m0/s1.
What are the key properties of [(1R,5S)-3-ethynyl-5-hydroxy-2-methylcyclohex-2-en-1-yl] butanoate?
[(1R,5S)-3-ethynyl-5-hydroxy-2-methylcyclohex-2-en-1-yl] butanoate has a molecular weight of 222.28 g/mol, XLogP of 1.80, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,5S)-3-ethynyl-5-hydroxy-2-methylcyclohex-2-en-1-yl] butanoate is sourced from PubChem (CID 10036499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).