C8H5F4NS — CID 10036526
N-(2,3,5,6-tetrafluorophenyl)ethanethioamide (PubChem CID 10036526) has the molecular formula C8H5F4NS and a molecular weight of 223.19 g/mol. Its IUPAC name is N-(2,3,5,6-tetrafluorophenyl)ethanethioamide.
| Compound Name | N-(2,3,5,6-tetrafluorophenyl)ethanethioamide |
|---|---|
| PubChem CID | 10036526 |
| Molecular Formula | C8H5F4NS |
| Molecular Weight | 223.19 g/mol |
| Exact Mass | 223.01 |
| IUPAC Name | N-(2,3,5,6-tetrafluorophenyl)ethanethioamide |
| SMILES | CC(=S)Nc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C8H5F4NS/c1-3(14)13-8-6(11)4(9)2-5(10)7(8)12/h2H,1H3,(H,13,14) |
| InChIKey | CHFRYOBPXAFTKF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.19 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|