About 2-(diethylamino)thieno[2,3-d][1,3]oxazin-4-one
2-(diethylamino)thieno[2,3-d][1,3]oxazin-4-one (PubChem CID 10036576) has the molecular formula C10H12N2O2S
and a molecular weight of 224.28 g/mol. Its IUPAC name is 2-(diethylamino)thieno[2,3-d][1,3]oxazin-4-one.
Molecular Properties
| Compound Name | 2-(diethylamino)thieno[2,3-d][1,3]oxazin-4-one |
| PubChem CID | 10036576 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 2-(diethylamino)thieno[2,3-d][1,3]oxazin-4-one |
| SMILES | CCN(CC)c1nc2sccc2c(=O)o1 |
| InChI | InChI=1S/C10H12N2O2S/c1-3-12(4-2)10-11-8-7(5-6-15-8)9(13)14-10/h5-6H,3-4H2,1-2H3 |
| InChIKey | WCJBHIWPJAUBKU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(diethylamino)thieno[2,3-d][1,3]oxazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)thieno[2,3-d][1,3]oxazin-4-one?
The IUPAC name of 2-(diethylamino)thieno[2,3-d][1,3]oxazin-4-one (CID 10036576) is 2-(diethylamino)thieno[2,3-d][1,3]oxazin-4-one.
What is the SMILES notation for 2-(diethylamino)thieno[2,3-d][1,3]oxazin-4-one?
The canonical SMILES for 2-(diethylamino)thieno[2,3-d][1,3]oxazin-4-one is CCN(CC)c1nc2sccc2c(=O)o1.
What is the InChIKey of 2-(diethylamino)thieno[2,3-d][1,3]oxazin-4-one?
The InChIKey is WCJBHIWPJAUBKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O2S/c1-3-12(4-2)10-11-8-7(5-6-15-8)9(13)14-10/h5-6H,3-4H2,1-2H3.
What are the key properties of 2-(diethylamino)thieno[2,3-d][1,3]oxazin-4-one?
2-(diethylamino)thieno[2,3-d][1,3]oxazin-4-one has a molecular weight of 224.28 g/mol, XLogP of 2.10, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)thieno[2,3-d][1,3]oxazin-4-one is sourced from PubChem (CID 10036576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).