C13H14N4 — CID 10036645
2,3,4,6-tetramethylimidazo[4,5-g]quinoxaline (PubChem CID 10036645) has the molecular formula C13H14N4 and a molecular weight of 226.28 g/mol. Its IUPAC name is 2,3,4,6-tetramethylimidazo[4,5-g]quinoxaline.
| Compound Name | 2,3,4,6-tetramethylimidazo[4,5-g]quinoxaline |
|---|---|
| PubChem CID | 10036645 |
| Molecular Formula | C13H14N4 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 2,3,4,6-tetramethylimidazo[4,5-g]quinoxaline |
| SMILES | Cc1cnc2cc3nc(C)n(C)c3c(C)c2n1 |
| InChI | InChI=1S/C13H14N4/c1-7-6-14-10-5-11-13(8(2)12(10)15-7)17(4)9(3)16-11/h5-6H,1-4H3 |
| InChIKey | OPNLDRHZJUCIFK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |