About 2-[amino-[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]acetic acid
2-[amino-[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]acetic acid (PubChem CID 10036667) has the molecular formula C8H9N3O5
and a molecular weight of 227.18 g/mol. Its IUPAC name is 2-[amino-[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]acetic acid.
Molecular Properties
| Compound Name | 2-[amino-[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]acetic acid |
| PubChem CID | 10036667 |
| Molecular Formula | C8H9N3O5 |
| Molecular Weight | 227.18 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | 2-[amino-[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]acetic acid |
| SMILES | NN(CC(=O)O)C(=O)CN1C(=O)C=CC1=O |
| InChI | InChI=1S/C8H9N3O5/c9-11(4-8(15)16)7(14)3-10-5(12)1-2-6(10)13/h1-2H,3-4,9H2,(H,15,16) |
| InChIKey | OCALFWRIWOTSFX-UHFFFAOYSA-N |
| XLogP | -2.30 |
| TPSA | 121.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.18 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[amino-[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[amino-[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]acetic acid?
The IUPAC name of 2-[amino-[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]acetic acid (CID 10036667) is 2-[amino-[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]acetic acid.
What is the SMILES notation for 2-[amino-[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]acetic acid?
The canonical SMILES for 2-[amino-[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]acetic acid is NN(CC(=O)O)C(=O)CN1C(=O)C=CC1=O.
What is the InChIKey of 2-[amino-[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]acetic acid?
The InChIKey is OCALFWRIWOTSFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O5/c9-11(4-8(15)16)7(14)3-10-5(12)1-2-6(10)13/h1-2H,3-4,9H2,(H,15,16).
What are the key properties of 2-[amino-[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]acetic acid?
2-[amino-[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]acetic acid has a molecular weight of 227.18 g/mol, XLogP of -2.30, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[amino-[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]acetic acid is sourced from PubChem (CID 10036667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).