About 2-(4-hydroxybutyl)-4,5-dimethoxypyridazin-3-one
2-(4-hydroxybutyl)-4,5-dimethoxypyridazin-3-one (PubChem CID 10036721) has the molecular formula C10H16N2O4
and a molecular weight of 228.25 g/mol. Its IUPAC name is 2-(4-hydroxybutyl)-4,5-dimethoxypyridazin-3-one.
Molecular Properties
| Compound Name | 2-(4-hydroxybutyl)-4,5-dimethoxypyridazin-3-one |
| PubChem CID | 10036721 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 2-(4-hydroxybutyl)-4,5-dimethoxypyridazin-3-one |
| SMILES | COc1cnn(CCCCO)c(=O)c1OC |
| InChI | InChI=1S/C10H16N2O4/c1-15-8-7-11-12(5-3-4-6-13)10(14)9(8)16-2/h7,13H,3-6H2,1-2H3 |
| InChIKey | SASZOKJHCQMMES-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-hydroxybutyl)-4,5-dimethoxypyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-hydroxybutyl)-4,5-dimethoxypyridazin-3-one?
The IUPAC name of 2-(4-hydroxybutyl)-4,5-dimethoxypyridazin-3-one (CID 10036721) is 2-(4-hydroxybutyl)-4,5-dimethoxypyridazin-3-one.
What is the SMILES notation for 2-(4-hydroxybutyl)-4,5-dimethoxypyridazin-3-one?
The canonical SMILES for 2-(4-hydroxybutyl)-4,5-dimethoxypyridazin-3-one is COc1cnn(CCCCO)c(=O)c1OC.
What is the InChIKey of 2-(4-hydroxybutyl)-4,5-dimethoxypyridazin-3-one?
The InChIKey is SASZOKJHCQMMES-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O4/c1-15-8-7-11-12(5-3-4-6-13)10(14)9(8)16-2/h7,13H,3-6H2,1-2H3.
What are the key properties of 2-(4-hydroxybutyl)-4,5-dimethoxypyridazin-3-one?
2-(4-hydroxybutyl)-4,5-dimethoxypyridazin-3-one has a molecular weight of 228.25 g/mol, XLogP of 0.03, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-hydroxybutyl)-4,5-dimethoxypyridazin-3-one is sourced from PubChem (CID 10036721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).