About 6-methoxyspiro[1H-quinoline-2,1'-cyclohexane]
6-methoxyspiro[1H-quinoline-2,1'-cyclohexane] (PubChem CID 10036794) has the molecular formula C15H19NO
and a molecular weight of 229.32 g/mol. Its IUPAC name is 6-methoxyspiro[1H-quinoline-2,1'-cyclohexane].
Molecular Properties
| Compound Name | 6-methoxyspiro[1H-quinoline-2,1'-cyclohexane] |
| PubChem CID | 10036794 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 6-methoxyspiro[1H-quinoline-2,1'-cyclohexane] |
| SMILES | COc1ccc2c(c1)C=CC1(CCCCC1)N2 |
| InChI | InChI=1S/C15H19NO/c1-17-13-5-6-14-12(11-13)7-10-15(16-14)8-3-2-4-9-15/h5-7,10-11,16H,2-4,8-9H2,1H3 |
| InChIKey | IPFFMYNNQBONIX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 6-methoxyspiro[1H-quinoline-2,1'-cyclohexane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxyspiro[1H-quinoline-2,1'-cyclohexane]?
The IUPAC name of 6-methoxyspiro[1H-quinoline-2,1'-cyclohexane] (CID 10036794) is 6-methoxyspiro[1H-quinoline-2,1'-cyclohexane].
What is the SMILES notation for 6-methoxyspiro[1H-quinoline-2,1'-cyclohexane]?
The canonical SMILES for 6-methoxyspiro[1H-quinoline-2,1'-cyclohexane] is COc1ccc2c(c1)C=CC1(CCCCC1)N2.
What is the InChIKey of 6-methoxyspiro[1H-quinoline-2,1'-cyclohexane]?
The InChIKey is IPFFMYNNQBONIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO/c1-17-13-5-6-14-12(11-13)7-10-15(16-14)8-3-2-4-9-15/h5-7,10-11,16H,2-4,8-9H2,1H3.
What are the key properties of 6-methoxyspiro[1H-quinoline-2,1'-cyclohexane]?
6-methoxyspiro[1H-quinoline-2,1'-cyclohexane] has a molecular weight of 229.32 g/mol, XLogP of 3.84, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxyspiro[1H-quinoline-2,1'-cyclohexane] is sourced from PubChem (CID 10036794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).