About 5-methoxy-1,2-dimethyl-4,7-dioxoindole-3-carbaldehyde
5-methoxy-1,2-dimethyl-4,7-dioxoindole-3-carbaldehyde (PubChem CID 10036947) has the molecular formula C12H11NO4
and a molecular weight of 233.22 g/mol. Its IUPAC name is 5-methoxy-1,2-dimethyl-4,7-dioxoindole-3-carbaldehyde.
Molecular Properties
| Compound Name | 5-methoxy-1,2-dimethyl-4,7-dioxoindole-3-carbaldehyde |
| PubChem CID | 10036947 |
| Molecular Formula | C12H11NO4 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 5-methoxy-1,2-dimethyl-4,7-dioxoindole-3-carbaldehyde |
| SMILES | COC1=CC(=O)c2c(c(C=O)c(C)n2C)C1=O |
| InChI | InChI=1S/C12H11NO4/c1-6-7(5-14)10-11(13(6)2)8(15)4-9(17-3)12(10)16/h4-5H,1-3H3 |
| InChIKey | ICLHAJWLRKVXHQ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-1,2-dimethyl-4,7-dioxoindole-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-1,2-dimethyl-4,7-dioxoindole-3-carbaldehyde?
The IUPAC name of 5-methoxy-1,2-dimethyl-4,7-dioxoindole-3-carbaldehyde (CID 10036947) is 5-methoxy-1,2-dimethyl-4,7-dioxoindole-3-carbaldehyde.
What is the SMILES notation for 5-methoxy-1,2-dimethyl-4,7-dioxoindole-3-carbaldehyde?
The canonical SMILES for 5-methoxy-1,2-dimethyl-4,7-dioxoindole-3-carbaldehyde is COC1=CC(=O)c2c(c(C=O)c(C)n2C)C1=O.
What is the InChIKey of 5-methoxy-1,2-dimethyl-4,7-dioxoindole-3-carbaldehyde?
The InChIKey is ICLHAJWLRKVXHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO4/c1-6-7(5-14)10-11(13(6)2)8(15)4-9(17-3)12(10)16/h4-5H,1-3H3.
What are the key properties of 5-methoxy-1,2-dimethyl-4,7-dioxoindole-3-carbaldehyde?
5-methoxy-1,2-dimethyl-4,7-dioxoindole-3-carbaldehyde has a molecular weight of 233.22 g/mol, XLogP of 1.06, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-1,2-dimethyl-4,7-dioxoindole-3-carbaldehyde is sourced from PubChem (CID 10036947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).