C13H15NO3 — CID 10036959
(3R,4S,5R)-1-benzyl-5-ethenyl-3,4-dihydroxypyrrolidin-2-one (PubChem CID 10036959) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is (3R,4S,5R)-1-benzyl-5-ethenyl-3,4-dihydroxypyrrolidin-2-one.
| Compound Name | (3R,4S,5R)-1-benzyl-5-ethenyl-3,4-dihydroxypyrrolidin-2-one |
|---|---|
| PubChem CID | 10036959 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | (3R,4S,5R)-1-benzyl-5-ethenyl-3,4-dihydroxypyrrolidin-2-one |
| SMILES | C=C[C@@H]1[C@H](O)[C@@H](O)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C13H15NO3/c1-2-10-11(15)12(16)13(17)14(10)8-9-6-4-3-5-7-9/h2-7,10-12,15-16H,1,8H2/t10-,11+,12-/m1/s1 |
| InChIKey | SJLGPRCUVWAPFF-GRYCIOLGSA-N |
| XLogP | 0.31 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|