About [(1R,3S)-5-fluoro-2-adamantylidene]-prop-2-enoxymethanol
[(1R,3S)-5-fluoro-2-adamantylidene]-prop-2-enoxymethanol (PubChem CID 10037208) has the molecular formula C14H19FO2
and a molecular weight of 238.30 g/mol. Its IUPAC name is [(1R,3S)-5-fluoro-2-adamantylidene]-prop-2-enoxymethanol.
Molecular Properties
| Compound Name | [(1R,3S)-5-fluoro-2-adamantylidene]-prop-2-enoxymethanol |
| PubChem CID | 10037208 |
| Molecular Formula | C14H19FO2 |
| Molecular Weight | 238.30 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | [(1R,3S)-5-fluoro-2-adamantylidene]-prop-2-enoxymethanol |
| SMILES | C=CCO/C(O)=C1\[C@@H]2CC3C[C@H]1CC(F)(C3)C2 |
| InChI | InChI=1S/C14H19FO2/c1-2-3-17-13(16)12-10-4-9-5-11(12)8-14(15,6-9)7-10/h2,9-11,16H,1,3-8H2/b13-12-/t9?,10-,11+,14?/m0/s1 |
| InChIKey | HVXASLCCEINKOK-AVJPTONSSA-N |
| XLogP | 3.51 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.30 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1R,3S)-5-fluoro-2-adamantylidene]-prop-2-enoxymethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,3S)-5-fluoro-2-adamantylidene]-prop-2-enoxymethanol?
The IUPAC name of [(1R,3S)-5-fluoro-2-adamantylidene]-prop-2-enoxymethanol (CID 10037208) is [(1R,3S)-5-fluoro-2-adamantylidene]-prop-2-enoxymethanol.
What is the SMILES notation for [(1R,3S)-5-fluoro-2-adamantylidene]-prop-2-enoxymethanol?
The canonical SMILES for [(1R,3S)-5-fluoro-2-adamantylidene]-prop-2-enoxymethanol is C=CCO/C(O)=C1\[C@@H]2CC3C[C@H]1CC(F)(C3)C2.
What is the InChIKey of [(1R,3S)-5-fluoro-2-adamantylidene]-prop-2-enoxymethanol?
The InChIKey is HVXASLCCEINKOK-AVJPTONSSA-N. The full InChI is InChI=1S/C14H19FO2/c1-2-3-17-13(16)12-10-4-9-5-11(12)8-14(15,6-9)7-10/h2,9-11,16H,1,3-8H2/b13-12-/t9?,10-,11+,14?/m0/s1.
What are the key properties of [(1R,3S)-5-fluoro-2-adamantylidene]-prop-2-enoxymethanol?
[(1R,3S)-5-fluoro-2-adamantylidene]-prop-2-enoxymethanol has a molecular weight of 238.30 g/mol, XLogP of 3.51, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,3S)-5-fluoro-2-adamantylidene]-prop-2-enoxymethanol is sourced from PubChem (CID 10037208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).