C16H14S — CID 10037222
tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-thiol (PubChem CID 10037222) has the molecular formula C16H14S and a molecular weight of 238.36 g/mol. Its IUPAC name is tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-thiol.
| Compound Name | tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-thiol |
|---|---|
| PubChem CID | 10037222 |
| Molecular Formula | C16H14S |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-thiol |
| SMILES | SC1CC2c3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C16H14S/c17-15-9-14-10-5-1-3-7-12(10)16(15)13-8-4-2-6-11(13)14/h1-8,14-17H,9H2 |
| InChIKey | FNHUFESPSQRQPG-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|