C13H8N2O3 — CID 10037274
3-hydroxy-4-oxa-7,10-diazatetracyclo[7.7.0.02,6.011,16]hexadeca-1,6,8,11,13,15-hexaen-5-one (PubChem CID 10037274) has the molecular formula C13H8N2O3 and a molecular weight of 240.22 g/mol. Its IUPAC name is 3-hydroxy-4-oxa-7,10-diazatetracyclo[7.7.0.02,6.011,16]hexadeca-1,6,8,11,13,15-hexaen-5-one.
| Compound Name | 3-hydroxy-4-oxa-7,10-diazatetracyclo[7.7.0.02,6.011,16]hexadeca-1,6,8,11,13,15-hexaen-5-one |
|---|---|
| PubChem CID | 10037274 |
| Molecular Formula | C13H8N2O3 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 3-hydroxy-4-oxa-7,10-diazatetracyclo[7.7.0.02,6.011,16]hexadeca-1,6,8,11,13,15-hexaen-5-one |
| SMILES | O=C1OC(O)c2c1ncc1[nH]c3ccccc3c21 |
| InChI | InChI=1S/C13H8N2O3/c16-12-10-9-6-3-1-2-4-7(6)15-8(9)5-14-11(10)13(17)18-12/h1-5,12,15-16H |
| InChIKey | HZOBEPXZYNIFGY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |