C12H16O5 — CID 10037277
ethyl (1S,5S,7S)-8-oxo-9,11-dioxatricyclo[5.3.1.01,5]undecane-7-carboxylate (PubChem CID 10037277) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is ethyl (1S,5S,7S)-8-oxo-9,11-dioxatricyclo[5.3.1.01,5]undecane-7-carboxylate.
| Compound Name | ethyl (1S,5S,7S)-8-oxo-9,11-dioxatricyclo[5.3.1.01,5]undecane-7-carboxylate |
|---|---|
| PubChem CID | 10037277 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | ethyl (1S,5S,7S)-8-oxo-9,11-dioxatricyclo[5.3.1.01,5]undecane-7-carboxylate |
| SMILES | CCOC(=O)[C@@]12C[C@@H]3CCC[C@]3(COC1=O)O2 |
| InChI | InChI=1S/C12H16O5/c1-2-15-9(13)12-6-8-4-3-5-11(8,17-12)7-16-10(12)14/h8H,2-7H2,1H3/t8-,11+,12-/m0/s1 |
| InChIKey | ANAJGWKSVORSPE-AXTRIDKLSA-N |
| XLogP | 0.80 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|