C16H22O2 — CID 10037570
(1R,2R,3R,10R)-11-methyl-2-prop-1-en-2-yl-13-oxabicyclo[8.2.1]tridec-11-en-4-yn-3-ol (PubChem CID 10037570) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is (1R,2R,3R,10R)-11-methyl-2-prop-1-en-2-yl-13-oxabicyclo[8.2.1]tridec-11-en-4-yn-3-ol.
| Compound Name | (1R,2R,3R,10R)-11-methyl-2-prop-1-en-2-yl-13-oxabicyclo[8.2.1]tridec-11-en-4-yn-3-ol |
|---|---|
| PubChem CID | 10037570 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | (1R,2R,3R,10R)-11-methyl-2-prop-1-en-2-yl-13-oxabicyclo[8.2.1]tridec-11-en-4-yn-3-ol |
| SMILES | C=C(C)[C@@H]1[C@@H](O)C#CCCCC[C@H]2O[C@@H]1C=C2C |
| InChI | InChI=1S/C16H22O2/c1-11(2)16-13(17)8-6-4-5-7-9-14-12(3)10-15(16)18-14/h10,13-17H,1,4-5,7,9H2,2-3H3/t13-,14+,15+,16+/m0/s1 |
| InChIKey | QXHSLMFOGAACPT-ZJIFWQFVSA-N |
| XLogP | 2.83 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|