C16H31NO — CID 10037923
2,2,7,7-tetramethyl-6-(2-methylpropylimino)octan-3-one (PubChem CID 10037923) has the molecular formula C16H31NO and a molecular weight of 253.43 g/mol. Its IUPAC name is 2,2,7,7-tetramethyl-6-(2-methylpropylimino)octan-3-one.
| Compound Name | 2,2,7,7-tetramethyl-6-(2-methylpropylimino)octan-3-one |
|---|---|
| PubChem CID | 10037923 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | 2,2,7,7-tetramethyl-6-(2-methylpropylimino)octan-3-one |
| SMILES | CC(C)C/N=C(\CCC(=O)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C16H31NO/c1-12(2)11-17-13(15(3,4)5)9-10-14(18)16(6,7)8/h12H,9-11H2,1-8H3/b17-13+ |
| InChIKey | CUUUZUUNRYRKQB-GHRIWEEISA-N |
| XLogP | 4.52 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|