C18H25N — CID 10038007
8-ethynyl-N,N-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 10038007) has the molecular formula C18H25N and a molecular weight of 255.40 g/mol. Its IUPAC name is 8-ethynyl-N,N-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | 8-ethynyl-N,N-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 10038007 |
| Molecular Formula | C18H25N |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.20 |
| IUPAC Name | 8-ethynyl-N,N-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | C#Cc1cccc2c1CC(N(CCC)CCC)CC2 |
| InChI | InChI=1S/C18H25N/c1-4-12-19(13-5-2)17-11-10-16-9-7-8-15(6-3)18(16)14-17/h3,7-9,17H,4-5,10-14H2,1-2H3 |
| InChIKey | LYBXSCJLHDEMEU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|