C13H24O3S — CID 10038256
(5S,6R)-5-[(2R,4R)-4-hydroxypentan-2-yl]oxy-2-methyl-6-sulfanylhept-3-yn-2-ol (PubChem CID 10038256) has the molecular formula C13H24O3S and a molecular weight of 260.40 g/mol. Its IUPAC name is (5S,6R)-5-[(2R,4R)-4-hydroxypentan-2-yl]oxy-2-methyl-6-sulfanylhept-3-yn-2-ol.
| Compound Name | (5S,6R)-5-[(2R,4R)-4-hydroxypentan-2-yl]oxy-2-methyl-6-sulfanylhept-3-yn-2-ol |
|---|---|
| PubChem CID | 10038256 |
| Molecular Formula | C13H24O3S |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | (5S,6R)-5-[(2R,4R)-4-hydroxypentan-2-yl]oxy-2-methyl-6-sulfanylhept-3-yn-2-ol |
| SMILES | C[C@H](C[C@@H](C)O)O[C@@H](C#CC(C)(C)O)[C@@H](C)S |
| InChI | InChI=1S/C13H24O3S/c1-9(14)8-10(2)16-12(11(3)17)6-7-13(4,5)15/h9-12,14-15,17H,8H2,1-5H3/t9-,10-,11-,12+/m1/s1 |
| InChIKey | HDTPYKNPUCHERJ-KKOKHZNYSA-N |
| XLogP | 1.62 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|