About N-(3,4-dihydroxyphenyl)-3,4-dihydroxybenzamide
N-(3,4-dihydroxyphenyl)-3,4-dihydroxybenzamide (PubChem CID 10038269) has the molecular formula C13H11NO5
and a molecular weight of 261.23 g/mol. Its IUPAC name is N-(3,4-dihydroxyphenyl)-3,4-dihydroxybenzamide.
Molecular Properties
| Compound Name | N-(3,4-dihydroxyphenyl)-3,4-dihydroxybenzamide |
| PubChem CID | 10038269 |
| Molecular Formula | C13H11NO5 |
| Molecular Weight | 261.23 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | N-(3,4-dihydroxyphenyl)-3,4-dihydroxybenzamide |
| SMILES | O=C(Nc1ccc(O)c(O)c1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C13H11NO5/c15-9-3-1-7(5-11(9)17)13(19)14-8-2-4-10(16)12(18)6-8/h1-6,15-18H,(H,14,19) |
| InChIKey | XIKSEDLKDYKPTO-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.23 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze N-(3,4-dihydroxyphenyl)-3,4-dihydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-dihydroxyphenyl)-3,4-dihydroxybenzamide?
The IUPAC name of N-(3,4-dihydroxyphenyl)-3,4-dihydroxybenzamide (CID 10038269) is N-(3,4-dihydroxyphenyl)-3,4-dihydroxybenzamide.
What is the SMILES notation for N-(3,4-dihydroxyphenyl)-3,4-dihydroxybenzamide?
The canonical SMILES for N-(3,4-dihydroxyphenyl)-3,4-dihydroxybenzamide is O=C(Nc1ccc(O)c(O)c1)c1ccc(O)c(O)c1.
What is the InChIKey of N-(3,4-dihydroxyphenyl)-3,4-dihydroxybenzamide?
The InChIKey is XIKSEDLKDYKPTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO5/c15-9-3-1-7(5-11(9)17)13(19)14-8-2-4-10(16)12(18)6-8/h1-6,15-18H,(H,14,19).
What are the key properties of N-(3,4-dihydroxyphenyl)-3,4-dihydroxybenzamide?
N-(3,4-dihydroxyphenyl)-3,4-dihydroxybenzamide has a molecular weight of 261.23 g/mol, XLogP of 1.76, 2 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-dihydroxyphenyl)-3,4-dihydroxybenzamide is sourced from PubChem (CID 10038269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).