C15H22N2O2 — CID 10038357
trans-(1R,2R)-2-[[(E)-(4-methoxyphenyl)methylideneamino]-methylamino]cyclohexan-1-ol (PubChem CID 10038357) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is trans-(1R,2R)-2-[[(E)-(4-methoxyphenyl)methylideneamino]-methylamino]cyclohexan-1-ol.
| Compound Name | trans-(1R,2R)-2-[[(E)-(4-methoxyphenyl)methylideneamino]-methylamino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 10038357 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | trans-(1R,2R)-2-[[(E)-(4-methoxyphenyl)methylideneamino]-methylamino]cyclohexan-1-ol |
| SMILES | COc1ccc(/C=N/N(C)[C@@H]2CCCC[C@H]2O)cc1 |
| InChI | InChI=1S/C15H22N2O2/c1-17(14-5-3-4-6-15(14)18)16-11-12-7-9-13(19-2)10-8-12/h7-11,14-15,18H,3-6H2,1-2H3/b16-11+/t14-,15-/m1/s1 |
| InChIKey | BOGNBUXUSYOZPO-AJMXMICASA-N |
| XLogP | 2.26 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|