About (3-benzoyl-2-oxido-4,5-dihydro-1,2-oxazol-2-ium-5-yl)methyl acetate
(3-benzoyl-2-oxido-4,5-dihydro-1,2-oxazol-2-ium-5-yl)methyl acetate (PubChem CID 10038385) has the molecular formula C13H13NO5
and a molecular weight of 263.25 g/mol. Its IUPAC name is (3-benzoyl-2-oxido-4,5-dihydro-1,2-oxazol-2-ium-5-yl)methyl acetate.
Molecular Properties
| Compound Name | (3-benzoyl-2-oxido-4,5-dihydro-1,2-oxazol-2-ium-5-yl)methyl acetate |
| PubChem CID | 10038385 |
| Molecular Formula | C13H13NO5 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | (3-benzoyl-2-oxido-4,5-dihydro-1,2-oxazol-2-ium-5-yl)methyl acetate |
| SMILES | CC(=O)OCC1CC(C(=O)c2ccccc2)=[N+]([O-])O1 |
| InChI | InChI=1S/C13H13NO5/c1-9(15)18-8-11-7-12(14(17)19-11)13(16)10-5-3-2-4-6-10/h2-6,11H,7-8H2,1H3 |
| InChIKey | UGPSDNHCIFKLRV-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-benzoyl-2-oxido-4,5-dihydro-1,2-oxazol-2-ium-5-yl)methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-benzoyl-2-oxido-4,5-dihydro-1,2-oxazol-2-ium-5-yl)methyl acetate?
The IUPAC name of (3-benzoyl-2-oxido-4,5-dihydro-1,2-oxazol-2-ium-5-yl)methyl acetate (CID 10038385) is (3-benzoyl-2-oxido-4,5-dihydro-1,2-oxazol-2-ium-5-yl)methyl acetate.
What is the SMILES notation for (3-benzoyl-2-oxido-4,5-dihydro-1,2-oxazol-2-ium-5-yl)methyl acetate?
The canonical SMILES for (3-benzoyl-2-oxido-4,5-dihydro-1,2-oxazol-2-ium-5-yl)methyl acetate is CC(=O)OCC1CC(C(=O)c2ccccc2)=[N+]([O-])O1.
What is the InChIKey of (3-benzoyl-2-oxido-4,5-dihydro-1,2-oxazol-2-ium-5-yl)methyl acetate?
The InChIKey is UGPSDNHCIFKLRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO5/c1-9(15)18-8-11-7-12(14(17)19-11)13(16)10-5-3-2-4-6-10/h2-6,11H,7-8H2,1H3.
What are the key properties of (3-benzoyl-2-oxido-4,5-dihydro-1,2-oxazol-2-ium-5-yl)methyl acetate?
(3-benzoyl-2-oxido-4,5-dihydro-1,2-oxazol-2-ium-5-yl)methyl acetate has a molecular weight of 263.25 g/mol, XLogP of 1.09, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-benzoyl-2-oxido-4,5-dihydro-1,2-oxazol-2-ium-5-yl)methyl acetate is sourced from PubChem (CID 10038385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).