C14H18O5 — CID 10038537
[(5S,7aS)-1,7a-dihydroxy-3,5,6,7-tetrahydro-1H-2-benzofuran-5-yl] (2E,4E)-hexa-2,4-dienoate (PubChem CID 10038537) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is [(5S,7aS)-1,7a-dihydroxy-3,5,6,7-tetrahydro-1H-2-benzofuran-5-yl] (2E,4E)-hexa-2,4-dienoate.
| Compound Name | [(5S,7aS)-1,7a-dihydroxy-3,5,6,7-tetrahydro-1H-2-benzofuran-5-yl] (2E,4E)-hexa-2,4-dienoate |
|---|---|
| PubChem CID | 10038537 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | [(5S,7aS)-1,7a-dihydroxy-3,5,6,7-tetrahydro-1H-2-benzofuran-5-yl] (2E,4E)-hexa-2,4-dienoate |
| SMILES | C/C=C/C=C/C(=O)O[C@@H]1C=C2COC(O)[C@]2(O)CC1 |
| InChI | InChI=1S/C14H18O5/c1-2-3-4-5-12(15)19-11-6-7-14(17)10(8-11)9-18-13(14)16/h2-5,8,11,13,16-17H,6-7,9H2,1H3/b3-2+,5-4+/t11-,13?,14-/m0/s1 |
| InChIKey | VOXUGQBSDOYPIT-XSWSBQJESA-N |
| XLogP | 0.83 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|