About 5-hydroxy-1-(1-hydroxyethyl)-3-methylbenzo[f][2]benzofuran-4,9-dione
5-hydroxy-1-(1-hydroxyethyl)-3-methylbenzo[f][2]benzofuran-4,9-dione (PubChem CID 10038862) has the molecular formula C15H12O5
and a molecular weight of 272.26 g/mol. Its IUPAC name is 5-hydroxy-1-(1-hydroxyethyl)-3-methylbenzo[f][2]benzofuran-4,9-dione.
Molecular Properties
| Compound Name | 5-hydroxy-1-(1-hydroxyethyl)-3-methylbenzo[f][2]benzofuran-4,9-dione |
| PubChem CID | 10038862 |
| Molecular Formula | C15H12O5 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 5-hydroxy-1-(1-hydroxyethyl)-3-methylbenzo[f][2]benzofuran-4,9-dione |
| SMILES | Cc1oc(C(C)O)c2c1C(=O)c1c(O)cccc1C2=O |
| InChI | InChI=1S/C15H12O5/c1-6(16)15-12-10(7(2)20-15)14(19)11-8(13(12)18)4-3-5-9(11)17/h3-6,16-17H,1-2H3 |
| InChIKey | VIBRJPNFOAVLAA-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxy-1-(1-hydroxyethyl)-3-methylbenzo[f][2]benzofuran-4,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-1-(1-hydroxyethyl)-3-methylbenzo[f][2]benzofuran-4,9-dione?
The IUPAC name of 5-hydroxy-1-(1-hydroxyethyl)-3-methylbenzo[f][2]benzofuran-4,9-dione (CID 10038862) is 5-hydroxy-1-(1-hydroxyethyl)-3-methylbenzo[f][2]benzofuran-4,9-dione.
What is the SMILES notation for 5-hydroxy-1-(1-hydroxyethyl)-3-methylbenzo[f][2]benzofuran-4,9-dione?
The canonical SMILES for 5-hydroxy-1-(1-hydroxyethyl)-3-methylbenzo[f][2]benzofuran-4,9-dione is Cc1oc(C(C)O)c2c1C(=O)c1c(O)cccc1C2=O.
What is the InChIKey of 5-hydroxy-1-(1-hydroxyethyl)-3-methylbenzo[f][2]benzofuran-4,9-dione?
The InChIKey is VIBRJPNFOAVLAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12O5/c1-6(16)15-12-10(7(2)20-15)14(19)11-8(13(12)18)4-3-5-9(11)17/h3-6,16-17H,1-2H3.
What are the key properties of 5-hydroxy-1-(1-hydroxyethyl)-3-methylbenzo[f][2]benzofuran-4,9-dione?
5-hydroxy-1-(1-hydroxyethyl)-3-methylbenzo[f][2]benzofuran-4,9-dione has a molecular weight of 272.26 g/mol, XLogP of 2.12, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-1-(1-hydroxyethyl)-3-methylbenzo[f][2]benzofuran-4,9-dione is sourced from PubChem (CID 10038862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).