About 2-amino-4-phenylindeno[1,2-d]pyrimidin-5-one
2-amino-4-phenylindeno[1,2-d]pyrimidin-5-one (PubChem CID 10038941) has the molecular formula C17H11N3O
and a molecular weight of 273.30 g/mol. Its IUPAC name is 2-amino-4-phenylindeno[1,2-d]pyrimidin-5-one.
Molecular Properties
| Compound Name | 2-amino-4-phenylindeno[1,2-d]pyrimidin-5-one |
| PubChem CID | 10038941 |
| Molecular Formula | C17H11N3O |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 2-amino-4-phenylindeno[1,2-d]pyrimidin-5-one |
| SMILES | Nc1nc(-c2ccccc2)c2c(n1)-c1ccccc1C2=O |
| InChI | InChI=1S/C17H11N3O/c18-17-19-14(10-6-2-1-3-7-10)13-15(20-17)11-8-4-5-9-12(11)16(13)21/h1-9H,(H2,18,19,20) |
| InChIKey | UVUYDEPVVFJIAY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-4-phenylindeno[1,2-d]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-phenylindeno[1,2-d]pyrimidin-5-one?
The IUPAC name of 2-amino-4-phenylindeno[1,2-d]pyrimidin-5-one (CID 10038941) is 2-amino-4-phenylindeno[1,2-d]pyrimidin-5-one.
What is the SMILES notation for 2-amino-4-phenylindeno[1,2-d]pyrimidin-5-one?
The canonical SMILES for 2-amino-4-phenylindeno[1,2-d]pyrimidin-5-one is Nc1nc(-c2ccccc2)c2c(n1)-c1ccccc1C2=O.
What is the InChIKey of 2-amino-4-phenylindeno[1,2-d]pyrimidin-5-one?
The InChIKey is UVUYDEPVVFJIAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11N3O/c18-17-19-14(10-6-2-1-3-7-10)13-15(20-17)11-8-4-5-9-12(11)16(13)21/h1-9H,(H2,18,19,20).
What are the key properties of 2-amino-4-phenylindeno[1,2-d]pyrimidin-5-one?
2-amino-4-phenylindeno[1,2-d]pyrimidin-5-one has a molecular weight of 273.30 g/mol, XLogP of 2.94, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-phenylindeno[1,2-d]pyrimidin-5-one is sourced from PubChem (CID 10038941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).