C12H25NO4Si — CID 10039088
(2R,3R,4R,5S)-2-(hydroxymethyl)-1-[(E)-3-trimethylsilylprop-2-enyl]piperidine-3,4,5-triol (PubChem CID 10039088) has the molecular formula C12H25NO4Si and a molecular weight of 275.42 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[(E)-3-trimethylsilylprop-2-enyl]piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[(E)-3-trimethylsilylprop-2-enyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 10039088 |
| Molecular Formula | C12H25NO4Si |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[(E)-3-trimethylsilylprop-2-enyl]piperidine-3,4,5-triol |
| SMILES | C[Si](C)(C)/C=C/CN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO |
| InChI | InChI=1S/C12H25NO4Si/c1-18(2,3)6-4-5-13-7-10(15)12(17)11(16)9(13)8-14/h4,6,9-12,14-17H,5,7-8H2,1-3H3/b6-4+/t9-,10+,11-,12-/m1/s1 |
| InChIKey | AHYWGPQILWVHMI-RANDFCPBSA-N |
| XLogP | -0.82 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|