About (5,11-dimethyl-6H-pyrido[4,3-b]carbazol-9-yl)methanol
(5,11-dimethyl-6H-pyrido[4,3-b]carbazol-9-yl)methanol (PubChem CID 10039119) has the molecular formula C18H16N2O
and a molecular weight of 276.34 g/mol. Its IUPAC name is (5,11-dimethyl-6H-pyrido[4,3-b]carbazol-9-yl)methanol.
Molecular Properties
| Compound Name | (5,11-dimethyl-6H-pyrido[4,3-b]carbazol-9-yl)methanol |
| PubChem CID | 10039119 |
| Molecular Formula | C18H16N2O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | (5,11-dimethyl-6H-pyrido[4,3-b]carbazol-9-yl)methanol |
| SMILES | Cc1c2ccncc2c(C)c2c1[nH]c1ccc(CO)cc12 |
| InChI | InChI=1S/C18H16N2O/c1-10-15-8-19-6-5-13(15)11(2)18-17(10)14-7-12(9-21)3-4-16(14)20-18/h3-8,20-21H,9H2,1-2H3 |
| InChIKey | BLXMRBDANRAFTB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5,11-dimethyl-6H-pyrido[4,3-b]carbazol-9-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5,11-dimethyl-6H-pyrido[4,3-b]carbazol-9-yl)methanol?
The IUPAC name of (5,11-dimethyl-6H-pyrido[4,3-b]carbazol-9-yl)methanol (CID 10039119) is (5,11-dimethyl-6H-pyrido[4,3-b]carbazol-9-yl)methanol.
What is the SMILES notation for (5,11-dimethyl-6H-pyrido[4,3-b]carbazol-9-yl)methanol?
The canonical SMILES for (5,11-dimethyl-6H-pyrido[4,3-b]carbazol-9-yl)methanol is Cc1c2ccncc2c(C)c2c1[nH]c1ccc(CO)cc12.
What is the InChIKey of (5,11-dimethyl-6H-pyrido[4,3-b]carbazol-9-yl)methanol?
The InChIKey is BLXMRBDANRAFTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O/c1-10-15-8-19-6-5-13(15)11(2)18-17(10)14-7-12(9-21)3-4-16(14)20-18/h3-8,20-21H,9H2,1-2H3.
What are the key properties of (5,11-dimethyl-6H-pyrido[4,3-b]carbazol-9-yl)methanol?
(5,11-dimethyl-6H-pyrido[4,3-b]carbazol-9-yl)methanol has a molecular weight of 276.34 g/mol, XLogP of 3.98, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5,11-dimethyl-6H-pyrido[4,3-b]carbazol-9-yl)methanol is sourced from PubChem (CID 10039119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).