C14H16O4S — CID 10039308
ethyl 1-(benzenesulfonyl)-2-ethenylcyclopropane-1-carboxylate (PubChem CID 10039308) has the molecular formula C14H16O4S and a molecular weight of 280.34 g/mol. Its IUPAC name is ethyl 1-(benzenesulfonyl)-2-ethenylcyclopropane-1-carboxylate.
| Compound Name | ethyl 1-(benzenesulfonyl)-2-ethenylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 10039308 |
| Molecular Formula | C14H16O4S |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | ethyl 1-(benzenesulfonyl)-2-ethenylcyclopropane-1-carboxylate |
| SMILES | C=CC1CC1(C(=O)OCC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H16O4S/c1-3-11-10-14(11,13(15)18-4-2)19(16,17)12-8-6-5-7-9-12/h3,5-9,11H,1,4,10H2,2H3 |
| InChIKey | KLVOUFUKHLWORN-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|