About 8,8-dimethyl-2-propan-2-yl-7H-phenanthrene-1,4-dione
8,8-dimethyl-2-propan-2-yl-7H-phenanthrene-1,4-dione (PubChem CID 10039317) has the molecular formula C19H20O2
and a molecular weight of 280.37 g/mol. Its IUPAC name is 8,8-dimethyl-2-propan-2-yl-7H-phenanthrene-1,4-dione.
Molecular Properties
| Compound Name | 8,8-dimethyl-2-propan-2-yl-7H-phenanthrene-1,4-dione |
| PubChem CID | 10039317 |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 8,8-dimethyl-2-propan-2-yl-7H-phenanthrene-1,4-dione |
| SMILES | CC(C)C1=CC(=O)c2c(ccc3c2C=CCC3(C)C)C1=O |
| InChI | InChI=1S/C19H20O2/c1-11(2)14-10-16(20)17-12-6-5-9-19(3,4)15(12)8-7-13(17)18(14)21/h5-8,10-11H,9H2,1-4H3 |
| InChIKey | QLYRTJYMSVNUFC-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 8,8-dimethyl-2-propan-2-yl-7H-phenanthrene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,8-dimethyl-2-propan-2-yl-7H-phenanthrene-1,4-dione?
The IUPAC name of 8,8-dimethyl-2-propan-2-yl-7H-phenanthrene-1,4-dione (CID 10039317) is 8,8-dimethyl-2-propan-2-yl-7H-phenanthrene-1,4-dione.
What is the SMILES notation for 8,8-dimethyl-2-propan-2-yl-7H-phenanthrene-1,4-dione?
The canonical SMILES for 8,8-dimethyl-2-propan-2-yl-7H-phenanthrene-1,4-dione is CC(C)C1=CC(=O)c2c(ccc3c2C=CCC3(C)C)C1=O.
What is the InChIKey of 8,8-dimethyl-2-propan-2-yl-7H-phenanthrene-1,4-dione?
The InChIKey is QLYRTJYMSVNUFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20O2/c1-11(2)14-10-16(20)17-12-6-5-9-19(3,4)15(12)8-7-13(17)18(14)21/h5-8,10-11H,9H2,1-4H3.
What are the key properties of 8,8-dimethyl-2-propan-2-yl-7H-phenanthrene-1,4-dione?
8,8-dimethyl-2-propan-2-yl-7H-phenanthrene-1,4-dione has a molecular weight of 280.37 g/mol, XLogP of 4.34, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8,8-dimethyl-2-propan-2-yl-7H-phenanthrene-1,4-dione is sourced from PubChem (CID 10039317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).