About 6-bromo-1,1,4,4,7-pentamethyl-2,3-dihydronaphthalene
6-bromo-1,1,4,4,7-pentamethyl-2,3-dihydronaphthalene (PubChem CID 10039346) has the molecular formula C15H21Br
and a molecular weight of 281.24 g/mol. Its IUPAC name is 6-bromo-1,1,4,4,7-pentamethyl-2,3-dihydronaphthalene.
Analyze 6-bromo-1,1,4,4,7-pentamethyl-2,3-dihydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1,1,4,4,7-pentamethyl-2,3-dihydronaphthalene?
The IUPAC name of 6-bromo-1,1,4,4,7-pentamethyl-2,3-dihydronaphthalene (CID 10039346) is 6-bromo-1,1,4,4,7-pentamethyl-2,3-dihydronaphthalene.
What is the SMILES notation for 6-bromo-1,1,4,4,7-pentamethyl-2,3-dihydronaphthalene?
The canonical SMILES for 6-bromo-1,1,4,4,7-pentamethyl-2,3-dihydronaphthalene is Cc1cc2c(cc1Br)C(C)(C)CCC2(C)C.
What is the InChIKey of 6-bromo-1,1,4,4,7-pentamethyl-2,3-dihydronaphthalene?
The InChIKey is ONNHBALCPUEXBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21Br/c1-10-8-11-12(9-13(10)16)15(4,5)7-6-14(11,2)3/h8-9H,6-7H2,1-5H3.
What are the key properties of 6-bromo-1,1,4,4,7-pentamethyl-2,3-dihydronaphthalene?
6-bromo-1,1,4,4,7-pentamethyl-2,3-dihydronaphthalene has a molecular weight of 281.24 g/mol, XLogP of 5.11, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1,1,4,4,7-pentamethyl-2,3-dihydronaphthalene is sourced from PubChem (CID 10039346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).