About trimethyl-[(1-phenyl-1,3-dihydroisoindol-2-yl)methyl]silane
trimethyl-[(1-phenyl-1,3-dihydroisoindol-2-yl)methyl]silane (PubChem CID 10039387) has the molecular formula C18H23NSi
and a molecular weight of 281.48 g/mol. Its IUPAC name is trimethyl-[(1-phenyl-1,3-dihydroisoindol-2-yl)methyl]silane.
Molecular Properties
| Compound Name | trimethyl-[(1-phenyl-1,3-dihydroisoindol-2-yl)methyl]silane |
| PubChem CID | 10039387 |
| Molecular Formula | C18H23NSi |
| Molecular Weight | 281.48 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | trimethyl-[(1-phenyl-1,3-dihydroisoindol-2-yl)methyl]silane |
| SMILES | C[Si](C)(C)CN1Cc2ccccc2C1c1ccccc1 |
| InChI | InChI=1S/C18H23NSi/c1-20(2,3)14-19-13-16-11-7-8-12-17(16)18(19)15-9-5-4-6-10-15/h4-12,18H,13-14H2,1-3H3 |
| InChIKey | FLQYGRUAQTXIBM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[(1-phenyl-1,3-dihydroisoindol-2-yl)methyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[(1-phenyl-1,3-dihydroisoindol-2-yl)methyl]silane?
The IUPAC name of trimethyl-[(1-phenyl-1,3-dihydroisoindol-2-yl)methyl]silane (CID 10039387) is trimethyl-[(1-phenyl-1,3-dihydroisoindol-2-yl)methyl]silane.
What is the SMILES notation for trimethyl-[(1-phenyl-1,3-dihydroisoindol-2-yl)methyl]silane?
The canonical SMILES for trimethyl-[(1-phenyl-1,3-dihydroisoindol-2-yl)methyl]silane is C[Si](C)(C)CN1Cc2ccccc2C1c1ccccc1.
What is the InChIKey of trimethyl-[(1-phenyl-1,3-dihydroisoindol-2-yl)methyl]silane?
The InChIKey is FLQYGRUAQTXIBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23NSi/c1-20(2,3)14-19-13-16-11-7-8-12-17(16)18(19)15-9-5-4-6-10-15/h4-12,18H,13-14H2,1-3H3.
What are the key properties of trimethyl-[(1-phenyl-1,3-dihydroisoindol-2-yl)methyl]silane?
trimethyl-[(1-phenyl-1,3-dihydroisoindol-2-yl)methyl]silane has a molecular weight of 281.48 g/mol, XLogP of 4.47, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[(1-phenyl-1,3-dihydroisoindol-2-yl)methyl]silane is sourced from PubChem (CID 10039387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).