About 4-(5-tert-butyl-1,3-dithian-2-yl)benzonitrile
4-(5-tert-butyl-1,3-dithian-2-yl)benzonitrile (PubChem CID 10039485) has the molecular formula C15H19NS2
and a molecular weight of 277.46 g/mol. Its IUPAC name is 4-(5-tert-butyl-1,3-dithian-2-yl)benzonitrile.
Molecular Properties
| Compound Name | 4-(5-tert-butyl-1,3-dithian-2-yl)benzonitrile |
| PubChem CID | 10039485 |
| Molecular Formula | C15H19NS2 |
| Molecular Weight | 277.46 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 4-(5-tert-butyl-1,3-dithian-2-yl)benzonitrile |
| SMILES | CC(C)(C)C1CSC(c2ccc(C#N)cc2)SC1 |
| InChI | InChI=1S/C15H19NS2/c1-15(2,3)13-9-17-14(18-10-13)12-6-4-11(8-16)5-7-12/h4-7,13-14H,9-10H2,1-3H3 |
| InChIKey | JBVUMTNJGGTVQA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.46 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(5-tert-butyl-1,3-dithian-2-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-tert-butyl-1,3-dithian-2-yl)benzonitrile?
The IUPAC name of 4-(5-tert-butyl-1,3-dithian-2-yl)benzonitrile (CID 10039485) is 4-(5-tert-butyl-1,3-dithian-2-yl)benzonitrile.
What is the SMILES notation for 4-(5-tert-butyl-1,3-dithian-2-yl)benzonitrile?
The canonical SMILES for 4-(5-tert-butyl-1,3-dithian-2-yl)benzonitrile is CC(C)(C)C1CSC(c2ccc(C#N)cc2)SC1.
What is the InChIKey of 4-(5-tert-butyl-1,3-dithian-2-yl)benzonitrile?
The InChIKey is JBVUMTNJGGTVQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NS2/c1-15(2,3)13-9-17-14(18-10-13)12-6-4-11(8-16)5-7-12/h4-7,13-14H,9-10H2,1-3H3.
What are the key properties of 4-(5-tert-butyl-1,3-dithian-2-yl)benzonitrile?
4-(5-tert-butyl-1,3-dithian-2-yl)benzonitrile has a molecular weight of 277.46 g/mol, XLogP of 4.70, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-tert-butyl-1,3-dithian-2-yl)benzonitrile is sourced from PubChem (CID 10039485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).