C19H25NO — CID 10039489
trans-(1R,2R)-2-spiro[indene-1,4'-piperidine]-1'-ylcyclohexan-1-ol (PubChem CID 10039489) has the molecular formula C19H25NO and a molecular weight of 283.41 g/mol. Its IUPAC name is trans-(1R,2R)-2-spiro[indene-1,4'-piperidine]-1'-ylcyclohexan-1-ol.
| Compound Name | trans-(1R,2R)-2-spiro[indene-1,4'-piperidine]-1'-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 10039489 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | trans-(1R,2R)-2-spiro[indene-1,4'-piperidine]-1'-ylcyclohexan-1-ol |
| SMILES | O[C@@H]1CCCC[C@H]1N1CCC2(C=Cc3ccccc32)CC1 |
| InChI | InChI=1S/C19H25NO/c21-18-8-4-3-7-17(18)20-13-11-19(12-14-20)10-9-15-5-1-2-6-16(15)19/h1-2,5-6,9-10,17-18,21H,3-4,7-8,11-14H2/t17-,18-/m1/s1 |
| InChIKey | FEEFZGDKGSHQMH-QZTJIDSGSA-N |
| XLogP | 3.35 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |