C16H28O4 — CID 10039543
(2R,3S)-2-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]-3-prop-2-enoxyoxepane (PubChem CID 10039543) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is (2R,3S)-2-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]-3-prop-2-enoxyoxepane.
| Compound Name | (2R,3S)-2-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]-3-prop-2-enoxyoxepane |
|---|---|
| PubChem CID | 10039543 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | (2R,3S)-2-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]-3-prop-2-enoxyoxepane |
| SMILES | C=CCO[C@H]1CCCCO[C@@H]1CCC1COC(C)(C)O1 |
| InChI | InChI=1S/C16H28O4/c1-4-10-17-14-7-5-6-11-18-15(14)9-8-13-12-19-16(2,3)20-13/h4,13-15H,1,5-12H2,2-3H3/t13?,14-,15+/m0/s1 |
| InChIKey | ZRVPXOQVBVYQLV-NOYMGPGASA-N |
| XLogP | 3.06 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|