About (4-heptanoylphenyl) sulfamate
(4-heptanoylphenyl) sulfamate (PubChem CID 10039578) has the molecular formula C13H19NO4S
and a molecular weight of 285.36 g/mol. Its IUPAC name is (4-heptanoylphenyl) sulfamate.
Molecular Properties
| Compound Name | (4-heptanoylphenyl) sulfamate |
| PubChem CID | 10039578 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | (4-heptanoylphenyl) sulfamate |
| SMILES | CCCCCCC(=O)c1ccc(OS(N)(=O)=O)cc1 |
| InChI | InChI=1S/C13H19NO4S/c1-2-3-4-5-6-13(15)11-7-9-12(10-8-11)18-19(14,16)17/h7-10H,2-6H2,1H3,(H2,14,16,17) |
| InChIKey | UNLHPJJZQQDTRV-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4-heptanoylphenyl) sulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-heptanoylphenyl) sulfamate?
The IUPAC name of (4-heptanoylphenyl) sulfamate (CID 10039578) is (4-heptanoylphenyl) sulfamate.
What is the SMILES notation for (4-heptanoylphenyl) sulfamate?
The canonical SMILES for (4-heptanoylphenyl) sulfamate is CCCCCCC(=O)c1ccc(OS(N)(=O)=O)cc1.
What is the InChIKey of (4-heptanoylphenyl) sulfamate?
The InChIKey is UNLHPJJZQQDTRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO4S/c1-2-3-4-5-6-13(15)11-7-9-12(10-8-11)18-19(14,16)17/h7-10H,2-6H2,1H3,(H2,14,16,17).
What are the key properties of (4-heptanoylphenyl) sulfamate?
(4-heptanoylphenyl) sulfamate has a molecular weight of 285.36 g/mol, XLogP of 2.42, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-heptanoylphenyl) sulfamate is sourced from PubChem (CID 10039578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).