About 1-bromo-4-(1,1,3,3,3-pentafluoroprop-1-en-2-yl)benzene
1-bromo-4-(1,1,3,3,3-pentafluoroprop-1-en-2-yl)benzene (PubChem CID 10039675) has the molecular formula C9H4BrF5
and a molecular weight of 287.03 g/mol. Its IUPAC name is 1-bromo-4-(1,1,3,3,3-pentafluoroprop-1-en-2-yl)benzene.
Analyze 1-bromo-4-(1,1,3,3,3-pentafluoroprop-1-en-2-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-(1,1,3,3,3-pentafluoroprop-1-en-2-yl)benzene?
The IUPAC name of 1-bromo-4-(1,1,3,3,3-pentafluoroprop-1-en-2-yl)benzene (CID 10039675) is 1-bromo-4-(1,1,3,3,3-pentafluoroprop-1-en-2-yl)benzene.
What is the SMILES notation for 1-bromo-4-(1,1,3,3,3-pentafluoroprop-1-en-2-yl)benzene?
The canonical SMILES for 1-bromo-4-(1,1,3,3,3-pentafluoroprop-1-en-2-yl)benzene is FC(F)=C(c1ccc(Br)cc1)C(F)(F)F.
What is the InChIKey of 1-bromo-4-(1,1,3,3,3-pentafluoroprop-1-en-2-yl)benzene?
The InChIKey is VIGZIGNDORZRMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4BrF5/c10-6-3-1-5(2-4-6)7(8(11)12)9(13,14)15/h1-4H.
What are the key properties of 1-bromo-4-(1,1,3,3,3-pentafluoroprop-1-en-2-yl)benzene?
1-bromo-4-(1,1,3,3,3-pentafluoroprop-1-en-2-yl)benzene has a molecular weight of 287.03 g/mol, XLogP of 4.62, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-(1,1,3,3,3-pentafluoroprop-1-en-2-yl)benzene is sourced from PubChem (CID 10039675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).