C15H16N2O4 — CID 10039736
(6-amino-4,7-dimethyl-5,8-dioxo-2,3-dihydro-1H-pyrrolo[1,2-a]indol-3-yl) acetate (PubChem CID 10039736) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is (6-amino-4,7-dimethyl-5,8-dioxo-2,3-dihydro-1H-pyrrolo[1,2-a]indol-3-yl) acetate.
| Compound Name | (6-amino-4,7-dimethyl-5,8-dioxo-2,3-dihydro-1H-pyrrolo[1,2-a]indol-3-yl) acetate |
|---|---|
| PubChem CID | 10039736 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | (6-amino-4,7-dimethyl-5,8-dioxo-2,3-dihydro-1H-pyrrolo[1,2-a]indol-3-yl) acetate |
| SMILES | CC(=O)OC1CCn2c3c(c(C)c21)C(=O)C(N)=C(C)C3=O |
| InChI | InChI=1S/C15H16N2O4/c1-6-10-13(14(19)7(2)11(16)15(10)20)17-5-4-9(12(6)17)21-8(3)18/h9H,4-5,16H2,1-3H3 |
| InChIKey | UPRLPMYAESJSLE-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|