C20H32O — CID 10039786
(1R,3aS,5E,9E,12aS)-3a,6,10-trimethyl-1-prop-1-en-2-yl-2,3,4,7,8,11,12,12a-octahydrocyclopenta[11]annulen-1-ol (PubChem CID 10039786) has the molecular formula C20H32O and a molecular weight of 288.48 g/mol. Its IUPAC name is (1R,3aS,5E,9E,12aS)-3a,6,10-trimethyl-1-prop-1-en-2-yl-2,3,4,7,8,11,12,12a-octahydrocyclopenta[11]annulen-1-ol.
| Compound Name | (1R,3aS,5E,9E,12aS)-3a,6,10-trimethyl-1-prop-1-en-2-yl-2,3,4,7,8,11,12,12a-octahydrocyclopenta[11]annulen-1-ol |
|---|---|
| PubChem CID | 10039786 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | (1R,3aS,5E,9E,12aS)-3a,6,10-trimethyl-1-prop-1-en-2-yl-2,3,4,7,8,11,12,12a-octahydrocyclopenta[11]annulen-1-ol |
| SMILES | C=C(C)[C@@]1(O)CC[C@@]2(C)C/C=C(\C)CC/C=C(\C)CC[C@@H]21 |
| InChI | InChI=1S/C20H32O/c1-15(2)20(21)14-13-19(5)12-11-17(4)8-6-7-16(3)9-10-18(19)20/h7,11,18,21H,1,6,8-10,12-14H2,2-5H3/b16-7+,17-11+/t18-,19+,20-/m0/s1 |
| InChIKey | NUHPZDOCKJPIPC-UMFXKQKMSA-N |
| XLogP | 5.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|