About 6-(2-methoxyphenyl)-1,2-dihydropyrazolo[4,3-c]cinnolin-3-one
6-(2-methoxyphenyl)-1,2-dihydropyrazolo[4,3-c]cinnolin-3-one (PubChem CID 10039958) has the molecular formula C16H12N4O2
and a molecular weight of 292.30 g/mol. Its IUPAC name is 6-(2-methoxyphenyl)-1,2-dihydropyrazolo[4,3-c]cinnolin-3-one.
Molecular Properties
| Compound Name | 6-(2-methoxyphenyl)-1,2-dihydropyrazolo[4,3-c]cinnolin-3-one |
| PubChem CID | 10039958 |
| Molecular Formula | C16H12N4O2 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 6-(2-methoxyphenyl)-1,2-dihydropyrazolo[4,3-c]cinnolin-3-one |
| SMILES | COc1ccccc1-c1cccc2c1nnc1c(=O)[nH][nH]c12 |
| InChI | InChI=1S/C16H12N4O2/c1-22-12-8-3-2-5-9(12)10-6-4-7-11-13(10)17-19-15-14(11)18-20-16(15)21/h2-8H,1H3,(H2,18,20,21) |
| InChIKey | GERGJQRCGWRRED-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(2-methoxyphenyl)-1,2-dihydropyrazolo[4,3-c]cinnolin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-methoxyphenyl)-1,2-dihydropyrazolo[4,3-c]cinnolin-3-one?
The IUPAC name of 6-(2-methoxyphenyl)-1,2-dihydropyrazolo[4,3-c]cinnolin-3-one (CID 10039958) is 6-(2-methoxyphenyl)-1,2-dihydropyrazolo[4,3-c]cinnolin-3-one.
What is the SMILES notation for 6-(2-methoxyphenyl)-1,2-dihydropyrazolo[4,3-c]cinnolin-3-one?
The canonical SMILES for 6-(2-methoxyphenyl)-1,2-dihydropyrazolo[4,3-c]cinnolin-3-one is COc1ccccc1-c1cccc2c1nnc1c(=O)[nH][nH]c12.
What is the InChIKey of 6-(2-methoxyphenyl)-1,2-dihydropyrazolo[4,3-c]cinnolin-3-one?
The InChIKey is GERGJQRCGWRRED-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N4O2/c1-22-12-8-3-2-5-9(12)10-6-4-7-11-13(10)17-19-15-14(11)18-20-16(15)21/h2-8H,1H3,(H2,18,20,21).
What are the key properties of 6-(2-methoxyphenyl)-1,2-dihydropyrazolo[4,3-c]cinnolin-3-one?
6-(2-methoxyphenyl)-1,2-dihydropyrazolo[4,3-c]cinnolin-3-one has a molecular weight of 292.30 g/mol, XLogP of 2.47, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-methoxyphenyl)-1,2-dihydropyrazolo[4,3-c]cinnolin-3-one is sourced from PubChem (CID 10039958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).