About [(Z)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)but-2-enyl] benzoate
[(Z)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)but-2-enyl] benzoate (PubChem CID 10040442) has the molecular formula C16H16N2O4
and a molecular weight of 300.31 g/mol. Its IUPAC name is [(Z)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)but-2-enyl] benzoate.
Molecular Properties
| Compound Name | [(Z)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)but-2-enyl] benzoate |
| PubChem CID | 10040442 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | [(Z)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)but-2-enyl] benzoate |
| SMILES | Cc1cn(C/C=C\COC(=O)c2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H16N2O4/c1-12-11-18(16(21)17-14(12)19)9-5-6-10-22-15(20)13-7-3-2-4-8-13/h2-8,11H,9-10H2,1H3,(H,17,19,21)/b6-5- |
| InChIKey | BHBWPKZQOWJAGH-WAYWQWQTSA-N |
| XLogP | 1.26 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)but-2-enyl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)but-2-enyl] benzoate?
The IUPAC name of [(Z)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)but-2-enyl] benzoate (CID 10040442) is [(Z)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)but-2-enyl] benzoate.
What is the SMILES notation for [(Z)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)but-2-enyl] benzoate?
The canonical SMILES for [(Z)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)but-2-enyl] benzoate is Cc1cn(C/C=C\COC(=O)c2ccccc2)c(=O)[nH]c1=O.
What is the InChIKey of [(Z)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)but-2-enyl] benzoate?
The InChIKey is BHBWPKZQOWJAGH-WAYWQWQTSA-N. The full InChI is InChI=1S/C16H16N2O4/c1-12-11-18(16(21)17-14(12)19)9-5-6-10-22-15(20)13-7-3-2-4-8-13/h2-8,11H,9-10H2,1H3,(H,17,19,21)/b6-5-.
What are the key properties of [(Z)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)but-2-enyl] benzoate?
[(Z)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)but-2-enyl] benzoate has a molecular weight of 300.31 g/mol, XLogP of 1.26, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)but-2-enyl] benzoate is sourced from PubChem (CID 10040442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).