About benzyl N-[(2S)-1-[(1S,4R)-2-oxa-3-azabicyclo[2.2.1]hept-5-en-3-yl]-1-oxopropan-2-yl]carbamate
benzyl N-[(2S)-1-[(1S,4R)-2-oxa-3-azabicyclo[2.2.1]hept-5-en-3-yl]-1-oxopropan-2-yl]carbamate (PubChem CID 10040580) has the molecular formula C16H18N2O4
and a molecular weight of 302.33 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[(1S,4R)-2-oxa-3-azabicyclo[2.2.1]hept-5-en-3-yl]-1-oxopropan-2-yl]carbamate.
Molecular Properties
| Compound Name | benzyl N-[(2S)-1-[(1S,4R)-2-oxa-3-azabicyclo[2.2.1]hept-5-en-3-yl]-1-oxopropan-2-yl]carbamate |
| PubChem CID | 10040580 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | benzyl N-[(2S)-1-[(1S,4R)-2-oxa-3-azabicyclo[2.2.1]hept-5-en-3-yl]-1-oxopropan-2-yl]carbamate |
| SMILES | C[C@H](NC(=O)OCc1ccccc1)C(=O)N1O[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C16H18N2O4/c1-11(15(19)18-13-7-8-14(9-13)22-18)17-16(20)21-10-12-5-3-2-4-6-12/h2-8,11,13-14H,9-10H2,1H3,(H,17,20)/t11-,13-,14+/m0/s1 |
| InChIKey | UEXYRLICAZSHRW-FPMFFAJLSA-N |
| XLogP | 1.77 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze benzyl N-[(2S)-1-[(1S,4R)-2-oxa-3-azabicyclo[2.2.1]hept-5-en-3-yl]-1-oxopropan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-[(2S)-1-[(1S,4R)-2-oxa-3-azabicyclo[2.2.1]hept-5-en-3-yl]-1-oxopropan-2-yl]carbamate?
The IUPAC name of benzyl N-[(2S)-1-[(1S,4R)-2-oxa-3-azabicyclo[2.2.1]hept-5-en-3-yl]-1-oxopropan-2-yl]carbamate (CID 10040580) is benzyl N-[(2S)-1-[(1S,4R)-2-oxa-3-azabicyclo[2.2.1]hept-5-en-3-yl]-1-oxopropan-2-yl]carbamate.
What is the SMILES notation for benzyl N-[(2S)-1-[(1S,4R)-2-oxa-3-azabicyclo[2.2.1]hept-5-en-3-yl]-1-oxopropan-2-yl]carbamate?
The canonical SMILES for benzyl N-[(2S)-1-[(1S,4R)-2-oxa-3-azabicyclo[2.2.1]hept-5-en-3-yl]-1-oxopropan-2-yl]carbamate is C[C@H](NC(=O)OCc1ccccc1)C(=O)N1O[C@@H]2C=C[C@H]1C2.
What is the InChIKey of benzyl N-[(2S)-1-[(1S,4R)-2-oxa-3-azabicyclo[2.2.1]hept-5-en-3-yl]-1-oxopropan-2-yl]carbamate?
The InChIKey is UEXYRLICAZSHRW-FPMFFAJLSA-N. The full InChI is InChI=1S/C16H18N2O4/c1-11(15(19)18-13-7-8-14(9-13)22-18)17-16(20)21-10-12-5-3-2-4-6-12/h2-8,11,13-14H,9-10H2,1H3,(H,17,20)/t11-,13-,14+/m0/s1.
What are the key properties of benzyl N-[(2S)-1-[(1S,4R)-2-oxa-3-azabicyclo[2.2.1]hept-5-en-3-yl]-1-oxopropan-2-yl]carbamate?
benzyl N-[(2S)-1-[(1S,4R)-2-oxa-3-azabicyclo[2.2.1]hept-5-en-3-yl]-1-oxopropan-2-yl]carbamate has a molecular weight of 302.33 g/mol, XLogP of 1.77, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-[(2S)-1-[(1S,4R)-2-oxa-3-azabicyclo[2.2.1]hept-5-en-3-yl]-1-oxopropan-2-yl]carbamate is sourced from PubChem (CID 10040580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).