C19H26O3 — CID 10040615
tert-butyl (1S,2S,3S,4S,7R,8S,9R,11S)-hexacyclo[6.5.1.02,7.03,11.04,9.010,14]tetradecane-1-carboperoxoate (PubChem CID 10040615) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is tert-butyl (1S,2S,3S,4S,7R,8S,9R,11S)-hexacyclo[6.5.1.02,7.03,11.04,9.010,14]tetradecane-1-carboperoxoate.
| Compound Name | tert-butyl (1S,2S,3S,4S,7R,8S,9R,11S)-hexacyclo[6.5.1.02,7.03,11.04,9.010,14]tetradecane-1-carboperoxoate |
|---|---|
| PubChem CID | 10040615 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | tert-butyl (1S,2S,3S,4S,7R,8S,9R,11S)-hexacyclo[6.5.1.02,7.03,11.04,9.010,14]tetradecane-1-carboperoxoate |
| SMILES | CC(C)(C)OOC(=O)[C@]12CC[C@@H]3C4C1C1[C@@H]4[C@@H]4CC[C@H]1[C@H]2[C@@H]43 |
| InChI | InChI=1S/C19H26O3/c1-18(2,3)22-21-17(20)19-7-6-9-11-8-4-5-10(15(11)19)14-12(8)13(9)16(14)19/h8-16H,4-7H2,1-3H3/t8-,9+,10-,11+,12-,13?,14?,15+,16?,19+/m1/s1 |
| InChIKey | LRPCKCZCVCPXJI-IYBKTXRFSA-N |
| XLogP | 3.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|