About (5E)-5-methoxy-3-(methoxymethoxy)-4-methyl-6-trimethylsilyloxyhepta-1,2,5-trien-4-ol
(5E)-5-methoxy-3-(methoxymethoxy)-4-methyl-6-trimethylsilyloxyhepta-1,2,5-trien-4-ol (PubChem CID 10040618) has the molecular formula C14H26O5Si
and a molecular weight of 302.44 g/mol. Its IUPAC name is (5E)-5-methoxy-3-(methoxymethoxy)-4-methyl-6-trimethylsilyloxyhepta-1,2,5-trien-4-ol.
Molecular Properties
| Compound Name | (5E)-5-methoxy-3-(methoxymethoxy)-4-methyl-6-trimethylsilyloxyhepta-1,2,5-trien-4-ol |
| PubChem CID | 10040618 |
| Molecular Formula | C14H26O5Si |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (5E)-5-methoxy-3-(methoxymethoxy)-4-methyl-6-trimethylsilyloxyhepta-1,2,5-trien-4-ol |
| SMILES | C=C=C(OCOC)C(C)(O)/C(OC)=C(/C)O[Si](C)(C)C |
| InChI | InChI=1S/C14H26O5Si/c1-9-12(18-10-16-4)14(3,15)13(17-5)11(2)19-20(6,7)8/h15H,1,10H2,2-8H3/b13-11+ |
| InChIKey | KMQXJRXLBBLTMC-ACCUITESSA-N |
| XLogP | 2.76 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (5E)-5-methoxy-3-(methoxymethoxy)-4-methyl-6-trimethylsilyloxyhepta-1,2,5-trien-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-5-methoxy-3-(methoxymethoxy)-4-methyl-6-trimethylsilyloxyhepta-1,2,5-trien-4-ol?
The IUPAC name of (5E)-5-methoxy-3-(methoxymethoxy)-4-methyl-6-trimethylsilyloxyhepta-1,2,5-trien-4-ol (CID 10040618) is (5E)-5-methoxy-3-(methoxymethoxy)-4-methyl-6-trimethylsilyloxyhepta-1,2,5-trien-4-ol.
What is the SMILES notation for (5E)-5-methoxy-3-(methoxymethoxy)-4-methyl-6-trimethylsilyloxyhepta-1,2,5-trien-4-ol?
The canonical SMILES for (5E)-5-methoxy-3-(methoxymethoxy)-4-methyl-6-trimethylsilyloxyhepta-1,2,5-trien-4-ol is C=C=C(OCOC)C(C)(O)/C(OC)=C(/C)O[Si](C)(C)C.
What is the InChIKey of (5E)-5-methoxy-3-(methoxymethoxy)-4-methyl-6-trimethylsilyloxyhepta-1,2,5-trien-4-ol?
The InChIKey is KMQXJRXLBBLTMC-ACCUITESSA-N. The full InChI is InChI=1S/C14H26O5Si/c1-9-12(18-10-16-4)14(3,15)13(17-5)11(2)19-20(6,7)8/h15H,1,10H2,2-8H3/b13-11+.
What are the key properties of (5E)-5-methoxy-3-(methoxymethoxy)-4-methyl-6-trimethylsilyloxyhepta-1,2,5-trien-4-ol?
(5E)-5-methoxy-3-(methoxymethoxy)-4-methyl-6-trimethylsilyloxyhepta-1,2,5-trien-4-ol has a molecular weight of 302.44 g/mol, XLogP of 2.76, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-5-methoxy-3-(methoxymethoxy)-4-methyl-6-trimethylsilyloxyhepta-1,2,5-trien-4-ol is sourced from PubChem (CID 10040618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).