About N-[2-[(5-methoxy-3,4-dihydro-2H-chromen-3-yl)-propylamino]ethyl]acetamide
N-[2-[(5-methoxy-3,4-dihydro-2H-chromen-3-yl)-propylamino]ethyl]acetamide (PubChem CID 10040815) has the molecular formula C17H26N2O3
and a molecular weight of 306.41 g/mol. Its IUPAC name is N-[2-[(5-methoxy-3,4-dihydro-2H-chromen-3-yl)-propylamino]ethyl]acetamide.
Molecular Properties
| Compound Name | N-[2-[(5-methoxy-3,4-dihydro-2H-chromen-3-yl)-propylamino]ethyl]acetamide |
| PubChem CID | 10040815 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | N-[2-[(5-methoxy-3,4-dihydro-2H-chromen-3-yl)-propylamino]ethyl]acetamide |
| SMILES | CCCN(CCNC(C)=O)C1COc2cccc(OC)c2C1 |
| InChI | InChI=1S/C17H26N2O3/c1-4-9-19(10-8-18-13(2)20)14-11-15-16(21-3)6-5-7-17(15)22-12-14/h5-7,14H,4,8-12H2,1-3H3,(H,18,20) |
| InChIKey | WLDXPKVWTUVBFJ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-[(5-methoxy-3,4-dihydro-2H-chromen-3-yl)-propylamino]ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(5-methoxy-3,4-dihydro-2H-chromen-3-yl)-propylamino]ethyl]acetamide?
The IUPAC name of N-[2-[(5-methoxy-3,4-dihydro-2H-chromen-3-yl)-propylamino]ethyl]acetamide (CID 10040815) is N-[2-[(5-methoxy-3,4-dihydro-2H-chromen-3-yl)-propylamino]ethyl]acetamide.
What is the SMILES notation for N-[2-[(5-methoxy-3,4-dihydro-2H-chromen-3-yl)-propylamino]ethyl]acetamide?
The canonical SMILES for N-[2-[(5-methoxy-3,4-dihydro-2H-chromen-3-yl)-propylamino]ethyl]acetamide is CCCN(CCNC(C)=O)C1COc2cccc(OC)c2C1.
What is the InChIKey of N-[2-[(5-methoxy-3,4-dihydro-2H-chromen-3-yl)-propylamino]ethyl]acetamide?
The InChIKey is WLDXPKVWTUVBFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O3/c1-4-9-19(10-8-18-13(2)20)14-11-15-16(21-3)6-5-7-17(15)22-12-14/h5-7,14H,4,8-12H2,1-3H3,(H,18,20).
What are the key properties of N-[2-[(5-methoxy-3,4-dihydro-2H-chromen-3-yl)-propylamino]ethyl]acetamide?
N-[2-[(5-methoxy-3,4-dihydro-2H-chromen-3-yl)-propylamino]ethyl]acetamide has a molecular weight of 306.41 g/mol, XLogP of 1.85, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(5-methoxy-3,4-dihydro-2H-chromen-3-yl)-propylamino]ethyl]acetamide is sourced from PubChem (CID 10040815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).